CAS 1212845-21-0 is the registry number for (S)-1-(4-Bromo-3-methylphenyl)-2,2,2-trifluoroethan-1-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S)-1-(4-bromo-3-methylphenyl)-2,2,2-trifluoroethanamine (CAS 1212845-21-0) is a chemical compound with the molecular formula C9H9BrF3N and a molecular weight of 268.07 g/mol. IUPAC name: (1S)-1-(4-bromo-3-methylphenyl)-2,2,2-trifluoroethanamine. InChIKey: JRZDQJZETQLPIF-QMMMGPOBSA-N.
| Molecular formula | C9H9BrF3N |
|---|---|
| Molecular weight | 268.07 g/mol |
| IUPAC name | (1S)-1-(4-bromo-3-methylphenyl)-2,2,2-trifluoroethanamine |
| InChIKey | JRZDQJZETQLPIF-QMMMGPOBSA-N |
| SMILES | CC1=C(C=CC(=C1)[C@@H](C(F)(F)F)N)Br |
Computed by PubChem (NCBI)