cas: 707-60-8 — see every product listed under this CAS number, including other names
4-Bromo-N,N-dimethyl-benzenesulfonamide, 98%, 98% (CAS 707-60-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114L1K-1g |
| cas | 707-60-8 |
| size | 1g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 150.80 Pln | |
| Chemat | 10g | 242.00 Pln | |
| Chemat | 25g | 501.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-bromo-N,N-dimethylbenzenesulfonamide (CAS 707-60-8) is a chemical compound with the molecular formula C8H10BrNO2S and a molecular weight of 264.14 g/mol. IUPAC name: 4-bromo-N,N-dimethylbenzenesulfonamide. InChIKey: NQAUNPZZVCXYEJ-UHFFFAOYSA-N.
| Molecular formula | C8H10BrNO2S |
|---|---|
| Molecular weight | 264.14 g/mol |
| IUPAC name | 4-bromo-N,N-dimethylbenzenesulfonamide |
| InChIKey | NQAUNPZZVCXYEJ-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)C1=CC=C(C=C1)Br |
Computed by PubChem (NCBI)