cas: 329939-43-7 — see every product listed under this CAS number, including other names
4-Bromo-N-(4-methoxybenzyl)benzenesulfonamide 98% (CAS 329939-43-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A875461-250mg |
| cas | 329939-43-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 286.94 Pln | |
| Ambeed | 1g | 542.81 Pln | |
| Ambeed | 5g | 1482.88 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A875461 |
4-bromo-N-[(4-methoxyphenyl)methyl]benzenesulfonamide (CAS 329939-43-7) is a chemical compound with the molecular formula C14H14BrNO3S and a molecular weight of 356.24 g/mol. IUPAC name: 4-bromo-N-[(4-methoxyphenyl)methyl]benzenesulfonamide. InChIKey: HKTIXZGUJGCYDO-UHFFFAOYSA-N.
| Molecular formula | C14H14BrNO3S |
|---|---|
| Molecular weight | 356.24 g/mol |
| IUPAC name | 4-bromo-N-[(4-methoxyphenyl)methyl]benzenesulfonamide |
| InChIKey | HKTIXZGUJGCYDO-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)CNS(=O)(=O)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)