cas: 149105-17-9 — see every product listed under this CAS number, including other names
4-Bromo-N-tert-butyl-3-methylbenzamide (CAS 149105-17-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F630553-1G |
| cas | 149105-17-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 2137.81 Pln | |
| Fluorochem | 5g | 6266.56 Pln |
| delivery time | 3-4 weeks |
|---|
4-bromo-N-tert-butyl-3-methylbenzamide (CAS 149105-17-9) is a chemical compound with the molecular formula C12H16BrNO and a molecular weight of 270.17 g/mol. IUPAC name: 4-bromo-N-tert-butyl-3-methylbenzamide. InChIKey: OQIREZZUEPXXKP-UHFFFAOYSA-N.
| Molecular formula | C12H16BrNO |
|---|---|
| Molecular weight | 270.17 g/mol |
| IUPAC name | 4-bromo-N-tert-butyl-3-methylbenzamide |
| InChIKey | OQIREZZUEPXXKP-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C(=O)NC(C)(C)C)Br |
Computed by PubChem (NCBI)