CAS 883801-90-9 is the registry number for 2-(3-Bromophenyl)-N-t-butylacetamide, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-(3-bromophenyl)-N-tert-butylacetamide (CAS 883801-90-9) is a chemical compound with the molecular formula C12H16BrNO and a molecular weight of 270.17 g/mol. IUPAC name: 2-(3-bromophenyl)-N-tert-butylacetamide. InChIKey: SAYMAMMCRGZMPA-UHFFFAOYSA-N.
| Molecular formula | C12H16BrNO |
|---|---|
| Molecular weight | 270.17 g/mol |
| IUPAC name | 2-(3-bromophenyl)-N-tert-butylacetamide |
| InChIKey | SAYMAMMCRGZMPA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NC(=O)CC1=CC(=CC=C1)Br |
Computed by PubChem (NCBI)