CAS 682778-12-7 is the registry number for 4-Bromo-N,N-diethyl-2-methylbenzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g, 25g.
4-bromo-N,N-diethyl-2-methylbenzamide (CAS 682778-12-7) is a chemical compound with the molecular formula C12H16BrNO and a molecular weight of 270.17 g/mol. IUPAC name: 4-bromo-N,N-diethyl-2-methylbenzamide. InChIKey: PAXICWGHOUCQKI-UHFFFAOYSA-N.
| Molecular formula | C12H16BrNO |
|---|---|
| Molecular weight | 270.17 g/mol |
| IUPAC name | 4-bromo-N,N-diethyl-2-methylbenzamide |
| InChIKey | PAXICWGHOUCQKI-UHFFFAOYSA-N |
| SMILES | CCN(CC)C(=O)C1=C(C=C(C=C1)Br)C |
Computed by PubChem (NCBI)