cas: 1263378-22-8 — see every product listed under this CAS number, including other names
4-Bromo-nicotinic acid methyl ester hydrobromide (CAS 1263378-22-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F631619-1G |
| cas | 1263378-22-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 3507.12 Pln | |
| Fluorochem | 5g | 10390.11 Pln |
| delivery time | 3-4 weeks |
|---|
Methyl 4-bromopyridine-3-carboxylate;hydrobromide (CAS 1263378-22-8) is a chemical compound with the molecular formula C7H7Br2NO2 and a molecular weight of 296.94 g/mol. IUPAC name: methyl 4-bromopyridine-3-carboxylate;hydrobromide. InChIKey: VCJVHCAMIHYKKA-UHFFFAOYSA-N.
| Molecular formula | C7H7Br2NO2 |
|---|---|
| Molecular weight | 296.94 g/mol |
| IUPAC name | methyl 4-bromopyridine-3-carboxylate;hydrobromide |
| InChIKey | VCJVHCAMIHYKKA-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CN=C1)Br.Br |
Computed by PubChem (NCBI)