cas: 2297-64-5 — see every product listed under this CAS number, including other names
4-Bromobenzenesulfonohydrazide, 97% (CAS 2297-64-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F365398-250MG |
| cas | 2297-64-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 122.89 Pln | |
| Fluorochem | 1g | 190.58 Pln | |
| Fluorochem | 5g | 476.93 Pln | |
| Fluorochem | 10g | 893.45 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
4-bromobenzenesulfonohydrazide (CAS 2297-64-5) is a chemical compound with the molecular formula C6H7BrN2O2S and a molecular weight of 251.10 g/mol. IUPAC name: 4-bromobenzenesulfonohydrazide. InChIKey: UXGNIMVLJMBZGY-UHFFFAOYSA-N.
| Molecular formula | C6H7BrN2O2S |
|---|---|
| Molecular weight | 251.10 g/mol |
| IUPAC name | 4-bromobenzenesulfonohydrazide |
| InChIKey | UXGNIMVLJMBZGY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1S(=O)(=O)NN)Br |
Computed by PubChem (NCBI)