cas: 2297-64-5 — see every product listed under this CAS number, including other names
Benzenesulfonic acid, 4-bromo-, hydrazide, 98%, 98% (CAS 2297-64-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113LR7-250mg |
| cas | 2297-64-5 |
| size | 250mg |
| availability | 40g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 1g | 146.00 Pln | |
| Chemat | 5g | 395.60 Pln | |
| Chemat | 10g | 587.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-bromobenzenesulfonohydrazide (CAS 2297-64-5) is a chemical compound with the molecular formula C6H7BrN2O2S and a molecular weight of 251.10 g/mol. IUPAC name: 4-bromobenzenesulfonohydrazide. InChIKey: UXGNIMVLJMBZGY-UHFFFAOYSA-N.
| Molecular formula | C6H7BrN2O2S |
|---|---|
| Molecular weight | 251.10 g/mol |
| IUPAC name | 4-bromobenzenesulfonohydrazide |
| InChIKey | UXGNIMVLJMBZGY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1S(=O)(=O)NN)Br |
Computed by PubChem (NCBI)