cas: 92-66-0 — see every product listed under this CAS number, including other names
4-Bromobiphenyl, 98.00% (CAS 92-66-0) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | CM46920K-10g |
| cas | 92-66-0 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 179.35 Pln | |
| Chemat | 25g | 312.80 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | 98.00% |
| category | Chemicals |
1-bromo-4-phenylbenzene (CAS 92-66-0) is a chemical compound with the molecular formula C12H9Br and a molecular weight of 233.10 g/mol. IUPAC name: 1-bromo-4-phenylbenzene. InChIKey: PKJBWOWQJHHAHG-UHFFFAOYSA-N.
| Molecular formula | C12H9Br |
|---|---|
| Molecular weight | 233.10 g/mol |
| IUPAC name | 1-bromo-4-phenylbenzene |
| InChIKey | PKJBWOWQJHHAHG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)