cas: 923590-95-8 — see every product listed under this CAS number, including other names
4-Bromoisoindoline hydrochloride, 98%, 98% (CAS 923590-95-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1144YI-100mg |
| cas | 923590-95-8 |
| size | 100mg |
| availability | 5000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 74.00 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 98.00 Pln | |
| Chemat | 5g | 237.20 Pln | |
| Chemat | 10g | 405.20 Pln | |
| Chemat | 25g | 750.80 Pln | |
| Chemat | 50g | 1235.60 Pln | |
| Chemat | 100g | 2128.40 Pln | |
| Chemat | 1kg | 11248.40 Pln | |
| Chemat | 5kg | 49200.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-bromo-2,3-dihydro-1H-isoindole;hydrochloride (CAS 923590-95-8) is a chemical compound with the molecular formula C8H9BrClN and a molecular weight of 234.52 g/mol. IUPAC name: 4-bromo-2,3-dihydro-1H-isoindole;hydrochloride. InChIKey: FQHLHVFOJBANKY-UHFFFAOYSA-N.
| Molecular formula | C8H9BrClN |
|---|---|
| Molecular weight | 234.52 g/mol |
| IUPAC name | 4-bromo-2,3-dihydro-1H-isoindole;hydrochloride |
| InChIKey | FQHLHVFOJBANKY-UHFFFAOYSA-N |
| SMILES | C1C2=C(CN1)C(=CC=C2)Br.Cl |
Computed by PubChem (NCBI)