CAS 923590-95-8 appears in our catalog under these names: 4-Bromoisoindoline hydrochloride 95%, 4-Bromoisoindoline hydrochloride, 4-Bromoisoindoline hydrochloride, 97%, 4-Bromoisoindoline hydrochloride, 98%, 98%, 4-Bromo-isoindoline hydrochloride, 97%. Offered by: Ambeed, Biosynth, Thermo Scientific (Acros), Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g.
4-bromo-2,3-dihydro-1H-isoindole;hydrochloride (CAS 923590-95-8) is a chemical compound with the molecular formula C8H9BrClN and a molecular weight of 234.52 g/mol. IUPAC name: 4-bromo-2,3-dihydro-1H-isoindole;hydrochloride. InChIKey: FQHLHVFOJBANKY-UHFFFAOYSA-N.
| Molecular formula | C8H9BrClN |
|---|---|
| Molecular weight | 234.52 g/mol |
| IUPAC name | 4-bromo-2,3-dihydro-1H-isoindole;hydrochloride |
| InChIKey | FQHLHVFOJBANKY-UHFFFAOYSA-N |
| SMILES | C1C2=C(CN1)C(=CC=C2)Br.Cl |
Computed by PubChem (NCBI)