CAS 919346-89-7 appears in our catalog under these names: 5-Bromoisoindoline Hydrochloride, 5-Bromoisoindoline hydrochloride 97%, 5-Bromoisoindoline hydrochloride, 98%, 98%, 5-Bromo-isoindoline hydrochloride, 97%. Offered by: TRC, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 500mg, 500g, 5g, 10g, 25g, 100g.
5-bromo-2,3-dihydro-1H-isoindole;hydrochloride (CAS 919346-89-7) is a chemical compound with the molecular formula C8H9BrClN and a molecular weight of 234.52 g/mol. IUPAC name: 5-bromo-2,3-dihydro-1H-isoindole;hydrochloride. InChIKey: GDMXNYRWVLBUDZ-UHFFFAOYSA-N.
| Molecular formula | C8H9BrClN |
|---|---|
| Molecular weight | 234.52 g/mol |
| IUPAC name | 5-bromo-2,3-dihydro-1H-isoindole;hydrochloride |
| InChIKey | GDMXNYRWVLBUDZ-UHFFFAOYSA-N |
| SMILES | C1C2=C(CN1)C=C(C=C2)Br.Cl |
Computed by PubChem (NCBI)