cas: 6952-89-2 — see every product listed under this CAS number, including other names
4-Bromophenyl cyclopropyl ketone, 95% (CAS 6952-89-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F204026-250MG |
| cas | 6952-89-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 128.10 Pln | |
| Fluorochem | 1g | 138.51 Pln | |
| Fluorochem | 5g | 258.26 Pln | |
| Fluorochem | 10g | 456.11 Pln | |
| Fluorochem | 25g | 794.53 Pln | |
| Fluorochem | 100g | 2424.16 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
(4-bromophenyl)-cyclopropylmethanone (CAS 6952-89-2) is a chemical compound with the molecular formula C10H9BrO and a molecular weight of 225.08 g/mol. IUPAC name: (4-bromophenyl)-cyclopropylmethanone. InChIKey: QTHHOINSCNBYQO-UHFFFAOYSA-N.
| Molecular formula | C10H9BrO |
|---|---|
| Molecular weight | 225.08 g/mol |
| IUPAC name | (4-bromophenyl)-cyclopropylmethanone |
| InChIKey | QTHHOINSCNBYQO-UHFFFAOYSA-N |
| SMILES | C1CC1C(=O)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)