cas: 50906-43-9 — see every product listed under this CAS number, including other names
4-Butoxy-3,5-dichlorobenzaldehyde, 98% (CAS 50906-43-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1709225-5g |
| cas | 50906-43-9 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 15557.29 Pln | |
| AmBeed | 10g | 26474.56 Pln | |
| AmBeed | 25g | 51948.19 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
4-butoxy-3,5-dichlorobenzaldehyde (CAS 50906-43-9) is a chemical compound with the molecular formula C11H12Cl2O2 and a molecular weight of 247.11 g/mol. IUPAC name: 4-butoxy-3,5-dichlorobenzaldehyde. InChIKey: HZEMMCYJOKRHFZ-UHFFFAOYSA-N.
| Molecular formula | C11H12Cl2O2 |
|---|---|
| Molecular weight | 247.11 g/mol |
| IUPAC name | 4-butoxy-3,5-dichlorobenzaldehyde |
| InChIKey | HZEMMCYJOKRHFZ-UHFFFAOYSA-N |
| SMILES | CCCCOC1=C(C=C(C=C1Cl)C=O)Cl |
Computed by PubChem (NCBI)