CAS 66202-88-8 appears in our catalog under these names: Methyl 2-(3,4-dichlorophenyl)-2-methylpropanoate, 95%, methyl 2–(3,4–dichlorophenyl)–2–methylpropanoate, methyl 2-(3,4-dichlorophenyl)-2-methylpropanoate. Offered by: Combi-blocks, GLPBio, Chemat. Available pack sizes: 1g, 250mg.
Methyl 2-(3,4-dichlorophenyl)-2-methylpropanoate (CAS 66202-88-8) is a chemical compound with the molecular formula C11H12Cl2O2 and a molecular weight of 247.11 g/mol. IUPAC name: methyl 2-(3,4-dichlorophenyl)-2-methylpropanoate. InChIKey: FMORPVVUJNPQHD-UHFFFAOYSA-N.
| Molecular formula | C11H12Cl2O2 |
|---|---|
| Molecular weight | 247.11 g/mol |
| IUPAC name | methyl 2-(3,4-dichlorophenyl)-2-methylpropanoate |
| InChIKey | FMORPVVUJNPQHD-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC(=C(C=C1)Cl)Cl)C(=O)OC |
Computed by PubChem (NCBI)