Products 220283-13-6
CAS 220283-13-6 is the registry number for tert-Butyl 2,4-dichlorobenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Tert-butyl 2,4-dichlorobenzoate (CAS 220283-13-6) is a chemical compound with the molecular formula C11H12Cl2O2 and a molecular weight of 247.11 g/mol. IUPAC name: tert-butyl 2,4-dichlorobenzoate. InChIKey: PXDDCUVFKNTKET-UHFFFAOYSA-N.
| Molecular formula | C11H12Cl2O2 |
|---|---|
| Molecular weight | 247.11 g/mol |
| IUPAC name | tert-butyl 2,4-dichlorobenzoate |
| InChIKey | PXDDCUVFKNTKET-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=C(C=C(C=C1)Cl)Cl |
Computed by PubChem (NCBI)