cas: 4897-31-8 — see every product listed under this CAS number, including other names
4-CHLORO-1-METHYL-5-NITRO-1H-IMIDAZOLE, 97% (CAS 4897-31-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F795166-100MG |
| cas | 4897-31-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 529.00 Pln | |
| Fluorochem | 250mg | 846.59 Pln | |
| Fluorochem | 1g | 1903.51 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
4-chloro-1-methyl-5-nitroimidazole (CAS 4897-31-8) is a chemical compound with the molecular formula C4H4ClN3O2 and a molecular weight of 161.55 g/mol. IUPAC name: 4-chloro-1-methyl-5-nitroimidazole. InChIKey: BYQOKNIMGIDSHN-UHFFFAOYSA-N.
| Molecular formula | C4H4ClN3O2 |
|---|---|
| Molecular weight | 161.55 g/mol |
| IUPAC name | 4-chloro-1-methyl-5-nitroimidazole |
| InChIKey | BYQOKNIMGIDSHN-UHFFFAOYSA-N |
| SMILES | CN1C=NC(=C1[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)