Products 1507000-65-8

CAS 1507000-65-8 is the registry number for 5-Chloro-1-methyl-1h-1,2,4-triazole-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

5-chloro-1-methyl-1,2,4-triazole-3-carboxylic acid (CAS 1507000-65-8) is a chemical compound with the molecular formula C4H4ClN3O2 and a molecular weight of 161.55 g/mol. IUPAC name: 5-chloro-1-methyl-1,2,4-triazole-3-carboxylic acid. InChIKey: MSTBNEXATWPHRK-UHFFFAOYSA-N.

Identity
Molecular formulaC4H4ClN3O2
Molecular weight161.55 g/mol
IUPAC name5-chloro-1-methyl-1,2,4-triazole-3-carboxylic acid
InChIKeyMSTBNEXATWPHRK-UHFFFAOYSA-N
SMILESCN1C(=NC(=N1)C(=O)O)Cl

Computed by PubChem (NCBI)