CAS 1428577-87-0 is the registry number for 5-Chloro-1-(methyl-d3)-4-nitro-1h-pyrazole, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 500mg.
5-chloro-4-nitro-1-(trideuteriomethyl)pyrazole (CAS 1428577-87-0) is a chemical compound with the molecular formula C4H4ClN3O2 and a molecular weight of 164.56 g/mol. IUPAC name: 5-chloro-4-nitro-1-(trideuteriomethyl)pyrazole. InChIKey: POXLZEWCWNUVDW-FIBGUPNXSA-N.
| Molecular formula | C4H4ClN3O2 |
|---|---|
| Molecular weight | 164.56 g/mol |
| IUPAC name | 5-chloro-4-nitro-1-(trideuteriomethyl)pyrazole |
| InChIKey | POXLZEWCWNUVDW-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])N1C(=C(C=N1)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)