cas: 890087-03-3 — see every product listed under this CAS number, including other names
4-CHLORO-2-CYCLOHEXYL-3H-IMIDAZO[4,5-C]QUINOLINE, 98% (CAS 890087-03-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F506010-100MG |
| cas | 890087-03-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 1408.90 Pln | |
| Fluorochem | 250mg | 2309.62 Pln | |
| Fluorochem | 1g | 5688.64 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
4-chloro-2-cyclohexyl-3H-imidazo[4,5-c]quinoline (CAS 890087-03-3) is a chemical compound with the molecular formula C16H16ClN3 and a molecular weight of 285.77 g/mol. IUPAC name: 4-chloro-2-cyclohexyl-3H-imidazo[4,5-c]quinoline. InChIKey: QFTZGHMEQSNDMN-UHFFFAOYSA-N.
| Molecular formula | C16H16ClN3 |
|---|---|
| Molecular weight | 285.77 g/mol |
| IUPAC name | 4-chloro-2-cyclohexyl-3H-imidazo[4,5-c]quinoline |
| InChIKey | QFTZGHMEQSNDMN-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)C2=NC3=C(N2)C(=NC4=CC=CC=C43)Cl |
Computed by PubChem (NCBI)