CAS 1189872-59-0 is the registry number for 4-(Naphthalen-2-yl)-4,5,6,7-tetrahydro-1H-imidazo(4,5-c)pyridine hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 1g.
4-naphthalen-2-yl-4,5,6,7-tetrahydro-1H-imidazo[4,5-c]pyridine;hydrochloride (CAS 1189872-59-0) is a chemical compound with the molecular formula C16H16ClN3 and a molecular weight of 285.77 g/mol. IUPAC name: 4-naphthalen-2-yl-4,5,6,7-tetrahydro-1H-imidazo[4,5-c]pyridine;hydrochloride. InChIKey: GPXTVQWSIGIDGT-UHFFFAOYSA-N.
| Molecular formula | C16H16ClN3 |
|---|---|
| Molecular weight | 285.77 g/mol |
| IUPAC name | 4-naphthalen-2-yl-4,5,6,7-tetrahydro-1H-imidazo[4,5-c]pyridine;hydrochloride |
| InChIKey | GPXTVQWSIGIDGT-UHFFFAOYSA-N |
| SMILES | C1CNC(C2=C1NC=N2)C3=CC4=CC=CC=C4C=C3.Cl |
Computed by PubChem (NCBI)