CAS 1183376-10-4 appears in our catalog under these names: 5-Chloro-1-(3-phenylpropyl)-1H-benzo(d)imidazol-2-amine, 95%, 5-Chloro-1-(3-phenylpropyl)-1H-1,3-benzodiazol-2-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 2,5g, 250mg.
5-chloro-1-(3-phenylpropyl)benzimidazol-2-amine (CAS 1183376-10-4) is a chemical compound with the molecular formula C16H16ClN3 and a molecular weight of 285.77 g/mol. IUPAC name: 5-chloro-1-(3-phenylpropyl)benzimidazol-2-amine. InChIKey: CZRAMJQALFPNAX-UHFFFAOYSA-N.
| Molecular formula | C16H16ClN3 |
|---|---|
| Molecular weight | 285.77 g/mol |
| IUPAC name | 5-chloro-1-(3-phenylpropyl)benzimidazol-2-amine |
| InChIKey | CZRAMJQALFPNAX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CCCN2C3=C(C=C(C=C3)Cl)N=C2N |
Computed by PubChem (NCBI)