cas: 51674-77-2 — see every product listed under this CAS number, including other names
4-CHLOROPYRIDO[3,2-D]PYRIMIDINE, 95% (CAS 51674-77-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F472360-250MG |
| cas | 51674-77-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 310.33 Pln | |
| Fluorochem | 1g | 659.16 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
4-chloropyrido[3,2-d]pyrimidine (CAS 51674-77-2) is a chemical compound with the molecular formula C7H4ClN3 and a molecular weight of 165.58 g/mol. IUPAC name: 4-chloropyrido[3,2-d]pyrimidine. InChIKey: PVTHTRIHQGKZNE-UHFFFAOYSA-N.
| Molecular formula | C7H4ClN3 |
|---|---|
| Molecular weight | 165.58 g/mol |
| IUPAC name | 4-chloropyrido[3,2-d]pyrimidine |
| InChIKey | PVTHTRIHQGKZNE-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=NC=N2)Cl)N=C1 |
Computed by PubChem (NCBI)