cas: 51674-77-2 — see every product listed under this CAS number, including other names
4-Chloropyrido[3,2-d]pyrimidine, 97%, 97% (CAS 51674-77-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11D91J-100mg |
| cas | 51674-77-2 |
| size | 100mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 131.60 Pln | |
| Chemat | 250mg | 179.60 Pln | |
| Chemat | 500mg | 294.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4-chloropyrido[3,2-d]pyrimidine (CAS 51674-77-2) is a chemical compound with the molecular formula C7H4ClN3 and a molecular weight of 165.58 g/mol. IUPAC name: 4-chloropyrido[3,2-d]pyrimidine. InChIKey: PVTHTRIHQGKZNE-UHFFFAOYSA-N.
| Molecular formula | C7H4ClN3 |
|---|---|
| Molecular weight | 165.58 g/mol |
| IUPAC name | 4-chloropyrido[3,2-d]pyrimidine |
| InChIKey | PVTHTRIHQGKZNE-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=NC=N2)Cl)N=C1 |
Computed by PubChem (NCBI)