CAS 51674-77-2 appears in our catalog under these names: 4-Chloropyrido[3,2-d]pyrimidine, 97%, 4-Chloropyrido[3,2-d]pyrimidine 95%, 4-Chloropyrido[3,2-d]pyrimidine, 97%, 97%, 4-CHLOROPYRIDO[3,2-D]PYRIMIDINE, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg, 500mg.
4-chloropyrido[3,2-d]pyrimidine (CAS 51674-77-2) is a chemical compound with the molecular formula C7H4ClN3 and a molecular weight of 165.58 g/mol. IUPAC name: 4-chloropyrido[3,2-d]pyrimidine. InChIKey: PVTHTRIHQGKZNE-UHFFFAOYSA-N.
| Molecular formula | C7H4ClN3 |
|---|---|
| Molecular weight | 165.58 g/mol |
| IUPAC name | 4-chloropyrido[3,2-d]pyrimidine |
| InChIKey | PVTHTRIHQGKZNE-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=NC=N2)Cl)N=C1 |
Computed by PubChem (NCBI)