cas: 63873-61-0 — see every product listed under this CAS number, including other names
4-CHLOROTHIENO[2,3-B]PYRIDINE-5-CARBONITRILE (CAS 63873-61-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F386820-250MG |
| cas | 63873-61-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 383.22 Pln | |
| Fluorochem | 1g | 1247.50 Pln |
| delivery time | 3-4 weeks |
|---|
4-chlorothieno[2,3-b]pyridine-5-carbonitrile (CAS 63873-61-0) is a chemical compound with the molecular formula C8H3ClN2S and a molecular weight of 194.64 g/mol. IUPAC name: 4-chlorothieno[2,3-b]pyridine-5-carbonitrile. InChIKey: MATKYBWAJURSDT-UHFFFAOYSA-N.
| Molecular formula | C8H3ClN2S |
|---|---|
| Molecular weight | 194.64 g/mol |
| IUPAC name | 4-chlorothieno[2,3-b]pyridine-5-carbonitrile |
| InChIKey | MATKYBWAJURSDT-UHFFFAOYSA-N |
| SMILES | C1=CSC2=NC=C(C(=C21)Cl)C#N |
Computed by PubChem (NCBI)