cas: 63873-61-0 — see every product listed under this CAS number, including other names
4-Chlorothieno[2,3-b]pyridine-5-carbonitrile, 97%, 97% (CAS 63873-61-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114L9M-100mg |
| cas | 63873-61-0 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 117.20 Pln | |
| Chemat | 250mg | 203.60 Pln | |
| Chemat | 1g | 621.20 Pln | |
| Chemat | 5g | 2848.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4-chlorothieno[2,3-b]pyridine-5-carbonitrile (CAS 63873-61-0) is a chemical compound with the molecular formula C8H3ClN2S and a molecular weight of 194.64 g/mol. IUPAC name: 4-chlorothieno[2,3-b]pyridine-5-carbonitrile. InChIKey: MATKYBWAJURSDT-UHFFFAOYSA-N.
| Molecular formula | C8H3ClN2S |
|---|---|
| Molecular weight | 194.64 g/mol |
| IUPAC name | 4-chlorothieno[2,3-b]pyridine-5-carbonitrile |
| InChIKey | MATKYBWAJURSDT-UHFFFAOYSA-N |
| SMILES | C1=CSC2=NC=C(C(=C21)Cl)C#N |
Computed by PubChem (NCBI)