CAS 1188232-19-0 appears in our catalog under these names: 4-Chlorobenzo[d]thiazole-2-carbonitrile, 95%, 4–Chlorobenzo(d)thiazole–2–carbonitrile. Offered by: Combi-blocks, GLPBio. Available pack sizes: 5g, 250mg, 1g, 100mg.
4-chloro-1,3-benzothiazole-2-carbonitrile (CAS 1188232-19-0) is a chemical compound with the molecular formula C8H3ClN2S and a molecular weight of 194.64 g/mol. IUPAC name: 4-chloro-1,3-benzothiazole-2-carbonitrile. InChIKey: RKSFAGLRRUAFLU-UHFFFAOYSA-N.
| Molecular formula | C8H3ClN2S |
|---|---|
| Molecular weight | 194.64 g/mol |
| IUPAC name | 4-chloro-1,3-benzothiazole-2-carbonitrile |
| InChIKey | RKSFAGLRRUAFLU-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Cl)N=C(S2)C#N |
Computed by PubChem (NCBI)