cas: 1256359-33-7 — see every product listed under this CAS number, including other names
4-CYANOMETHOXY-3,5-DIMETHYLPHENYLBORONIC ACID PINACOL ESTER, 95%, 95% (CAS 1256359-33-7) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111O85-1g |
| cas | 1256359-33-7 |
| size | 1g |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 712.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-[2,6-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]acetonitrile (CAS 1256359-33-7) is a chemical compound with the molecular formula C16H22BNO3 and a molecular weight of 287.2 g/mol. IUPAC name: 2-[2,6-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]acetonitrile. InChIKey: JUBYKYNIXFNKIL-UHFFFAOYSA-N.
| Molecular formula | C16H22BNO3 |
|---|---|
| Molecular weight | 287.2 g/mol |
| IUPAC name | 2-[2,6-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]acetonitrile |
| InChIKey | JUBYKYNIXFNKIL-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C(=C2)C)OCC#N)C |
Computed by PubChem (NCBI)