cas: 1803572-24-8 — see every product listed under this CAS number, including other names
4-Carboxymethylphenylalanine hydrochloride, 95%, 95% (CAS 1803572-24-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 50mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1132X0-100mg |
| cas | 1803572-24-8 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 789.20 Pln | |
| Chemat | 1g | 3626.00 Pln | |
| Chemat | 50mg | 424.40 Pln | |
| Chemat | 250mg | 1274.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-amino-3-[4-(carboxymethyl)phenyl]propanoic acid;hydrochloride (CAS 1803572-24-8) is a chemical compound with the molecular formula C11H14ClNO4 and a molecular weight of 259.68 g/mol. IUPAC name: 2-amino-3-[4-(carboxymethyl)phenyl]propanoic acid;hydrochloride. InChIKey: UHQUHPFJRUJHRH-UHFFFAOYSA-N.
| Molecular formula | C11H14ClNO4 |
|---|---|
| Molecular weight | 259.68 g/mol |
| IUPAC name | 2-amino-3-[4-(carboxymethyl)phenyl]propanoic acid;hydrochloride |
| InChIKey | UHQUHPFJRUJHRH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC(C(=O)O)N)CC(=O)O.Cl |
Computed by PubChem (NCBI)