CAS 1803572-24-8 appears in our catalog under these names: 2-Amino-3-[4-(carboxymethyl)phenyl]propanoic acid hydrochloride, 95%, 4–Carboxymethylphenylalanine Hydrocholoride, 2-Amino-3-(4-(carboxymethyl)phenyl)propanoic acid hydrochloride, 4-Carboxymethylphenylalanine hydrochloride, 95%, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat. Available pack sizes: 1g, 250mg, 100mg, 50mg, 0,5g.
2-amino-3-[4-(carboxymethyl)phenyl]propanoic acid;hydrochloride (CAS 1803572-24-8) is a chemical compound with the molecular formula C11H14ClNO4 and a molecular weight of 259.68 g/mol. IUPAC name: 2-amino-3-[4-(carboxymethyl)phenyl]propanoic acid;hydrochloride. InChIKey: UHQUHPFJRUJHRH-UHFFFAOYSA-N.
| Molecular formula | C11H14ClNO4 |
|---|---|
| Molecular weight | 259.68 g/mol |
| IUPAC name | 2-amino-3-[4-(carboxymethyl)phenyl]propanoic acid;hydrochloride |
| InChIKey | UHQUHPFJRUJHRH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC(C(=O)O)N)CC(=O)O.Cl |
Computed by PubChem (NCBI)