CAS 1803582-94-6 appears in our catalog under these names: 2-[benzyl(carboxymethyl)amino]acetic acid hydrochloride, 95%, 2-(Benzyl(carboxymethyl)amino)acetic acid hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g.
2-[benzyl(carboxymethyl)amino]acetic acid;hydrochloride (CAS 1803582-94-6) is a chemical compound with the molecular formula C11H14ClNO4 and a molecular weight of 259.68 g/mol. IUPAC name: 2-[benzyl(carboxymethyl)amino]acetic acid;hydrochloride. InChIKey: RNNIGIHJDJWUGM-UHFFFAOYSA-N.
| Molecular formula | C11H14ClNO4 |
|---|---|
| Molecular weight | 259.68 g/mol |
| IUPAC name | 2-[benzyl(carboxymethyl)amino]acetic acid;hydrochloride |
| InChIKey | RNNIGIHJDJWUGM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN(CC(=O)O)CC(=O)O.Cl |
Computed by PubChem (NCBI)