CAS 1891-14-1 appears in our catalog under these names: 4-Chloro-1,10-phenanthroline, 4-Chloro-1,10-phenanthroline, 95+%, 95+%, 4-Chloro-1,10-phenanthroline, 95+%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 2,5g, 100mg, 250mg, 1g.
4-chloro-1,10-phenanthroline (CAS 1891-14-1) is a chemical compound with the molecular formula C12H7ClN2 and a molecular weight of 214.65 g/mol. IUPAC name: 4-chloro-1,10-phenanthroline. InChIKey: BAEVILLEIGDCDN-UHFFFAOYSA-N.
| Molecular formula | C12H7ClN2 |
|---|---|
| Molecular weight | 214.65 g/mol |
| IUPAC name | 4-chloro-1,10-phenanthroline |
| InChIKey | BAEVILLEIGDCDN-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C3=NC=CC(=C3C=C2)Cl)N=C1 |
Computed by PubChem (NCBI)