CAS 7089-68-1 appears in our catalog under these names: 2–Chloro–1,10–phenanthroline, 2-Chloro-1,10-phenanthroline, >98.0%(HPLC)(T), 2-Chloro-1,10-phenanthroline 95%, 2-Chloro-1,10-phenanthroline, 95%, 95%, 2-Chloro-1,10-phenanthroline, 95%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 5g, 100mg, 1g, 500g, 250mg, 100g.
2-chloro-1,10-phenanthroline (CAS 7089-68-1) is a chemical compound with the molecular formula C12H7ClN2 and a molecular weight of 214.65 g/mol. IUPAC name: 2-chloro-1,10-phenanthroline. InChIKey: JHRMQHFRVPVGHL-UHFFFAOYSA-N.
| Molecular formula | C12H7ClN2 |
|---|---|
| Molecular weight | 214.65 g/mol |
| IUPAC name | 2-chloro-1,10-phenanthroline |
| InChIKey | JHRMQHFRVPVGHL-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C3=C(C=C2)C=CC(=N3)Cl)N=C1 |
Computed by PubChem (NCBI)