CAS 852314-01-3 is the registry number for 4-Chloro-1-(3-chlorophenyl)-1H-pyrazolo[3,4-d]pyrimidine, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-chloro-1-(3-chlorophenyl)pyrazolo[5,4-d]pyrimidine (CAS 852314-01-3) is a chemical compound with the molecular formula C11H6Cl2N4 and a molecular weight of 265.09 g/mol. IUPAC name: 4-chloro-1-(3-chlorophenyl)pyrazolo[5,4-d]pyrimidine. InChIKey: HTCSVFHWWKNXID-UHFFFAOYSA-N.
| Molecular formula | C11H6Cl2N4 |
|---|---|
| Molecular weight | 265.09 g/mol |
| IUPAC name | 4-chloro-1-(3-chlorophenyl)pyrazolo[5,4-d]pyrimidine |
| InChIKey | HTCSVFHWWKNXID-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)N2C3=C(C=N2)C(=NC=N3)Cl |
Computed by PubChem (NCBI)