CAS 5334-59-8 is the registry number for 4-Chloro-1-(4-chlorophenyl)-1h-pyrazolo[3,4-d]pyrimidine, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g, 250mg.
4-chloro-1-(4-chlorophenyl)pyrazolo[5,4-d]pyrimidine (CAS 5334-59-8) is a chemical compound with the molecular formula C11H6Cl2N4 and a molecular weight of 265.09 g/mol. IUPAC name: 4-chloro-1-(4-chlorophenyl)pyrazolo[5,4-d]pyrimidine. InChIKey: PVDCVYNCXXQMPX-UHFFFAOYSA-N.
| Molecular formula | C11H6Cl2N4 |
|---|---|
| Molecular weight | 265.09 g/mol |
| IUPAC name | 4-chloro-1-(4-chlorophenyl)pyrazolo[5,4-d]pyrimidine |
| InChIKey | PVDCVYNCXXQMPX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N2C3=C(C=N2)C(=NC=N3)Cl)Cl |
Computed by PubChem (NCBI)