Products 74900-59-7
CAS 74900-59-7 is the registry number for 2-Amino-1-(1-aza-2-(2,4-dichlorophenyl)vinyl)ethene-1,2-dicarbonitrile. Offered by: Biosynth. Available pack sizes: 1000mg, 500mg, 2000mg.
(Z)-2-amino-3-[(2,4-dichlorophenyl)methylideneamino]but-2-enedinitrile (CAS 74900-59-7) is a chemical compound with the molecular formula C11H6Cl2N4 and a molecular weight of 265.09 g/mol. IUPAC name: (Z)-2-amino-3-[(2,4-dichlorophenyl)methylideneamino]but-2-enedinitrile. InChIKey: URBKTPMIMOJNPL-XZMRHVKESA-N.
| Molecular formula | C11H6Cl2N4 |
|---|---|
| Molecular weight | 265.09 g/mol |
| IUPAC name | (Z)-2-amino-3-[(2,4-dichlorophenyl)methylideneamino]but-2-enedinitrile |
| InChIKey | URBKTPMIMOJNPL-XZMRHVKESA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)C=N/C(=C(/C#N)\N)/C#N |
Computed by PubChem (NCBI)