cas: 744209-63-0 — see every product listed under this CAS number, including other names
4-Chloro-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine 98% (CAS 744209-63-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A455223-250mg |
| cas | 744209-63-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 136.75 Pln | |
| Ambeed | 5g | 236.88 Pln | |
| Ambeed | 10g | 398.19 Pln | |
| Ambeed | 25g | 832.06 Pln | |
| Ambeed | 100g | 2361.75 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A455223 |
1-(benzenesulfonyl)-4-chloropyrrolo[2,3-b]pyridine (CAS 744209-63-0) is a chemical compound with the molecular formula C13H9ClN2O2S and a molecular weight of 292.74 g/mol. IUPAC name: 1-(benzenesulfonyl)-4-chloropyrrolo[2,3-b]pyridine. InChIKey: ZWIKJILDMNXRAR-UHFFFAOYSA-N.
| Molecular formula | C13H9ClN2O2S |
|---|---|
| Molecular weight | 292.74 g/mol |
| IUPAC name | 1-(benzenesulfonyl)-4-chloropyrrolo[2,3-b]pyridine |
| InChIKey | ZWIKJILDMNXRAR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)N2C=CC3=C(C=CN=C32)Cl |
Computed by PubChem (NCBI)