cas: 744209-63-0 — see every product listed under this CAS number, including other names
4-Chloro-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine, 98%, 98% (CAS 744209-63-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11FBY4-250mg |
| cas | 744209-63-0 |
| size | 250mg |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 112.40 Pln | |
| Chemat | 5g | 179.60 Pln | |
| Chemat | 10g | 275.60 Pln | |
| Chemat | 25g | 544.40 Pln | |
| Chemat | 50g | 890.00 Pln | |
| Chemat | 100g | 1576.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-(benzenesulfonyl)-4-chloropyrrolo[2,3-b]pyridine (CAS 744209-63-0) is a chemical compound with the molecular formula C13H9ClN2O2S and a molecular weight of 292.74 g/mol. IUPAC name: 1-(benzenesulfonyl)-4-chloropyrrolo[2,3-b]pyridine. InChIKey: ZWIKJILDMNXRAR-UHFFFAOYSA-N.
| Molecular formula | C13H9ClN2O2S |
|---|---|
| Molecular weight | 292.74 g/mol |
| IUPAC name | 1-(benzenesulfonyl)-4-chloropyrrolo[2,3-b]pyridine |
| InChIKey | ZWIKJILDMNXRAR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)N2C=CC3=C(C=CN=C32)Cl |
Computed by PubChem (NCBI)