cas: 1013-04-3 — see every product listed under this CAS number, including other names
4-Chloro-1-naphthoic acid 98% (CAS 1013-04-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A453840-100mg |
| cas | 1013-04-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 159.00 Pln | |
| Ambeed | 250mg | 203.50 Pln | |
| Ambeed | 1g | 320.31 Pln | |
| Ambeed | 5g | 1321.56 Pln | |
| Ambeed | 25g | 6322.25 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A453840 |
4-chloronaphthalene-1-carboxylic acid (CAS 1013-04-3) is a chemical compound with the molecular formula C11H7ClO2 and a molecular weight of 206.62 g/mol. IUPAC name: 4-chloronaphthalene-1-carboxylic acid. InChIKey: SHCCGXNIGGRSMX-UHFFFAOYSA-N.
| Molecular formula | C11H7ClO2 |
|---|---|
| Molecular weight | 206.62 g/mol |
| IUPAC name | 4-chloronaphthalene-1-carboxylic acid |
| InChIKey | SHCCGXNIGGRSMX-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC=C2Cl)C(=O)O |
Computed by PubChem (NCBI)