cas: 1013-04-3 — see every product listed under this CAS number, including other names
4-Chloro-1-naphthoic acid, 95% (CAS 1013-04-3) is a chemical reagent available from Chemat. Available pack sizes: 10g, 1g, 5g, 250mg, 25g, 100mg. Offered by: Combi-blocks, Fluorochem.
| brand | Combi-blocks |
|---|---|
| catalog number | QJ-4147-10g |
| cas | 1013-04-3 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 10g | price on request | |
| Combi-blocks | 1g | price on request | |
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 250mg | price on request | |
| Fluorochem | 25g | 6344.66 Pln | |
| Fluorochem | 100mg | 143.72 Pln | |
| Fluorochem | 250mg | 185.37 Pln | |
| Fluorochem | 1g | 310.33 Pln | |
| Fluorochem | 5g | 1315.18 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
4-chloronaphthalene-1-carboxylic acid (CAS 1013-04-3) is a chemical compound with the molecular formula C11H7ClO2 and a molecular weight of 206.62 g/mol. IUPAC name: 4-chloronaphthalene-1-carboxylic acid. InChIKey: SHCCGXNIGGRSMX-UHFFFAOYSA-N.
| Molecular formula | C11H7ClO2 |
|---|---|
| Molecular weight | 206.62 g/mol |
| IUPAC name | 4-chloronaphthalene-1-carboxylic acid |
| InChIKey | SHCCGXNIGGRSMX-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC=C2Cl)C(=O)O |
Computed by PubChem (NCBI)