cas: 2056110-34-8 — see every product listed under this CAS number, including other names
4-Chloro-2,3-difluoro-5-hydroxybenzaldehyde (CAS 2056110-34-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F631659-5G |
| cas | 2056110-34-8 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 15575.78 Pln | |
| Fluorochem | 1g | 5235.67 Pln |
| delivery time | 3-4 weeks |
|---|
4-chloro-2,3-difluoro-5-hydroxybenzaldehyde (CAS 2056110-34-8) is a chemical compound with the molecular formula C7H3ClF2O2 and a molecular weight of 192.55 g/mol. IUPAC name: 4-chloro-2,3-difluoro-5-hydroxybenzaldehyde. InChIKey: DXSDUISJPIECCG-UHFFFAOYSA-N.
| Molecular formula | C7H3ClF2O2 |
|---|---|
| Molecular weight | 192.55 g/mol |
| IUPAC name | 4-chloro-2,3-difluoro-5-hydroxybenzaldehyde |
| InChIKey | DXSDUISJPIECCG-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1O)Cl)F)F)C=O |
Computed by PubChem (NCBI)