4-Chloro-2,9-dimethyl-1,10-phenanthroline, 95%
cas: 2131054-09-4 — see every product listed under this CAS number, including other names
4-Chloro-2,9-dimethyl-1,10-phenanthroline, 95% (CAS 2131054-09-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch13344C-100mg |
| cas | 2131054-09-4 |
| size | 100mg |
| availability | 499.9g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 165.20 Pln | |
| Chemat | 250mg | 232.40 Pln | |
| Chemat | 1g | 405.20 Pln | |
| Chemat | 5g | 1029.20 Pln | |
| Chemat | 10g | 1442.00 Pln | |
| Chemat | 25g | 2474.00 Pln | |
| Chemat | 50g | 3506.00 Pln | |
| Chemat | 100g | 5229.20 Pln | |
| Chemat | 250g | 6952.40 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-chloro-2,9-dimethyl-1,10-phenanthroline (CAS 2131054-09-4) is a chemical compound with the molecular formula C14H11ClN2 and a molecular weight of 242.70 g/mol. IUPAC name: 4-chloro-2,9-dimethyl-1,10-phenanthroline. InChIKey: XXTXRRPENAEEIR-UHFFFAOYSA-N.
| Molecular formula | C14H11ClN2 |
|---|---|
| Molecular weight | 242.70 g/mol |
| IUPAC name | 4-chloro-2,9-dimethyl-1,10-phenanthroline |
| InChIKey | XXTXRRPENAEEIR-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C=C1)C=CC3=C(C=C(N=C32)C)Cl |
Computed by PubChem (NCBI)