Products 2131054-09-4
CAS 2131054-09-4 is the registry number for 4-Chloro-2,9-dimethyl-1,10-phenanthroline, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g.
4-chloro-2,9-dimethyl-1,10-phenanthroline (CAS 2131054-09-4) is a chemical compound with the molecular formula C14H11ClN2 and a molecular weight of 242.70 g/mol. IUPAC name: 4-chloro-2,9-dimethyl-1,10-phenanthroline. InChIKey: XXTXRRPENAEEIR-UHFFFAOYSA-N.
| Molecular formula | C14H11ClN2 |
|---|---|
| Molecular weight | 242.70 g/mol |
| IUPAC name | 4-chloro-2,9-dimethyl-1,10-phenanthroline |
| InChIKey | XXTXRRPENAEEIR-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C=C1)C=CC3=C(C=C(N=C32)C)Cl |
Computed by PubChem (NCBI)