4-Chloro-2-(3-ethoxyphenyl)quinazoline, 95%
cas: 2901099-87-2 — see every product listed under this CAS number, including other names
4-Chloro-2-(3-ethoxyphenyl)quinazoline, 95% (CAS 2901099-87-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 50mg. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A1665978-100mg |
| cas | 2901099-87-2 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 637.38 Pln | |
| Ambeed | 250mg | 1093.50 Pln | |
| Ambeed | 1g | 3335.19 Pln | |
| BLDpharm | 50mg | 436.54 Pln | |
| BLDpharm | 100mg | 680.90 Pln | |
| BLDpharm | 250mg | 1169.61 Pln | |
| BLDpharm | 1g | 3590.98 Pln | |
| Chemat | 50mg | 386.00 Pln | |
| Chemat | 100mg | 606.80 Pln | |
| Chemat | 250mg | 1043.60 Pln | |
| Chemat | 1g | 3198.80 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
4-chloro-2-(3-ethoxyphenyl)quinazoline (CAS 2901099-87-2) is a chemical compound with the molecular formula C16H13ClN2O and a molecular weight of 284.74 g/mol. IUPAC name: 4-chloro-2-(3-ethoxyphenyl)quinazoline. InChIKey: WVCDTGPBEXIHNJ-UHFFFAOYSA-N.
| Molecular formula | C16H13ClN2O |
|---|---|
| Molecular weight | 284.74 g/mol |
| IUPAC name | 4-chloro-2-(3-ethoxyphenyl)quinazoline |
| InChIKey | WVCDTGPBEXIHNJ-UHFFFAOYSA-N |
| SMILES | CCOC1=CC=CC(=C1)C2=NC3=CC=CC=C3C(=N2)Cl |
Computed by PubChem (NCBI)