CAS 1216457-46-3 appears in our catalog under these names: Diazepam-13C,d3, Diazepam-13C,d3 (1.0mg/ml in Acetonitrile). Offered by: TRC. Available pack sizes: 10mg, 1mg, 1x1ml.
7-chloro-5-phenyl-1-(trideuterio(113C)methyl)-3H-1,4-benzodiazepin-2-one (CAS 1216457-46-3) is a chemical compound with the molecular formula C16H13ClN2O and a molecular weight of 288.75 g/mol. IUPAC name: 7-chloro-5-phenyl-1-(trideuterio(113C)methyl)-3H-1,4-benzodiazepin-2-one. InChIKey: AAOVKJBEBIDNHE-KQORAOOSSA-N.
| Molecular formula | C16H13ClN2O |
|---|---|
| Molecular weight | 288.75 g/mol |
| IUPAC name | 7-chloro-5-phenyl-1-(trideuterio(113C)methyl)-3H-1,4-benzodiazepin-2-one |
| InChIKey | AAOVKJBEBIDNHE-KQORAOOSSA-N |
| SMILES | [2H][13C]([2H])([2H])N1C(=O)CN=C(C2=C1C=CC(=C2)Cl)C3=CC=CC=C3 |
Computed by PubChem (NCBI)