CAS 1246815-50-8 appears in our catalog under these names: Mazindol-d4 (1mg/ml in Acetonitrile), Mazindol-D4, >95% (HPLC), Mazindol-d4. Offered by: TRC, Biosynth. Available pack sizes: 1x1ml, 2,5mg, 25mg, 10mg, 5mg, 50mg.
5-(4-chlorophenyl)-2,2,3,3-tetradeuterioimidazo[1,2-b]isoindol-5-ol (CAS 1246815-50-8) is a chemical compound with the molecular formula C16H13ClN2O and a molecular weight of 288.76 g/mol. IUPAC name: 5-(4-chlorophenyl)-2,2,3,3-tetradeuterioimidazo[1,2-b]isoindol-5-ol. InChIKey: ZPXSCAKFGYXMGA-YQUBHJMPSA-N.
| Molecular formula | C16H13ClN2O |
|---|---|
| Molecular weight | 288.76 g/mol |
| IUPAC name | 5-(4-chlorophenyl)-2,2,3,3-tetradeuterioimidazo[1,2-b]isoindol-5-ol |
| InChIKey | ZPXSCAKFGYXMGA-YQUBHJMPSA-N |
| SMILES | [2H]C1(C(N2C(=N1)C3=CC=CC=C3C2(C4=CC=C(C=C4)Cl)O)([2H])[2H])[2H] |
Computed by PubChem (NCBI)