4-Chloro-2-(methylthio)-5,6,7,8-tetrahydroquinazoline, 97%
cas: 51660-11-8 — see every product listed under this CAS number, including other names
4-Chloro-2-(methylthio)-5,6,7,8-tetrahydroquinazoline, 97% (CAS 51660-11-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A390127-250mg |
| cas | 51660-11-8 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 375.94 Pln | |
| Ambeed | 1g | 887.69 Pln | |
| Ambeed | 5g | 2912.44 Pln | |
| Chemat | 250mg | 347.60 Pln | |
| Chemat | 1g | 827.60 Pln | |
| Chemat | 5g | 2738.00 Pln | |
| BLDpharm | 250mg | 403.22 Pln | |
| BLDpharm | 1g | 947.47 Pln | |
| BLDpharm | 5g | 3135.59 Pln | |
| Fluorochem | 5g | 5074.27 Pln | |
| Fluorochem | 250mg | 633.13 Pln | |
| Fluorochem | 1g | 1539.06 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
4-chloro-2-methylsulfanyl-5,6,7,8-tetrahydroquinazoline (CAS 51660-11-8) is a chemical compound with the molecular formula C9H11ClN2S and a molecular weight of 214.72 g/mol. IUPAC name: 4-chloro-2-methylsulfanyl-5,6,7,8-tetrahydroquinazoline. InChIKey: XDQBZDZLOKZGBN-UHFFFAOYSA-N.
| Molecular formula | C9H11ClN2S |
|---|---|
| Molecular weight | 214.72 g/mol |
| IUPAC name | 4-chloro-2-methylsulfanyl-5,6,7,8-tetrahydroquinazoline |
| InChIKey | XDQBZDZLOKZGBN-UHFFFAOYSA-N |
| SMILES | CSC1=NC2=C(CCCC2)C(=N1)Cl |
Computed by PubChem (NCBI)
Synonyms:
4-Chloro-2-(methylthio)-5,6,7,8-tetrahydroquinazoline, 4-chloro-2-methylsulfanyl-5,6,7,8-tetrahydroquinazoline, C9H11ClN2S, 4-chloro-2-(methylsulfanyl)-5,6,7,8-tetrahydroquinazoline, Quinazoline, 4-chloro-5,6,7,8-tetrahydro-2-(methylthio)-, 4-Chloro-5,6,7,8-tetrahydro-2-(methylthio)quinazoline, 4-chloro-5,6,7,8-tetrahydro-2-(methylthio)quinazoline 9H11ClN2S