CAS 58094-09-0 is the registry number for 4-Amino-4,5,6,7-tetrahydro-1-benzothiophene-2-carbonitrile hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-amino-4,5,6,7-tetrahydro-1-benzothiophene-2-carbonitrile;hydrochloride (CAS 58094-09-0) is a chemical compound with the molecular formula C9H11ClN2S and a molecular weight of 214.72 g/mol. IUPAC name: 4-amino-4,5,6,7-tetrahydro-1-benzothiophene-2-carbonitrile;hydrochloride. InChIKey: PAHZQMQUGRZSCS-UHFFFAOYSA-N.
| Molecular formula | C9H11ClN2S |
|---|---|
| Molecular weight | 214.72 g/mol |
| IUPAC name | 4-amino-4,5,6,7-tetrahydro-1-benzothiophene-2-carbonitrile;hydrochloride |
| InChIKey | PAHZQMQUGRZSCS-UHFFFAOYSA-N |
| SMILES | C1CC(C2=C(C1)SC(=C2)C#N)N.Cl |
Computed by PubChem (NCBI)